Products 2454181-83-8
CAS 2454181-83-8 appears in our catalog under these names: Itaconate-alkyne/ 99.17% (existing batch purity), 4–octynyl Itaconate, 4-octynyl Itaconate, Itaconate-alkyne, 98.01%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 100 mg.
2-methylidene-4-oct-7-ynoxy-4-oxobutanoic acid (CAS 2454181-83-8) is a chemical compound with the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. IUPAC name: 2-methylidene-4-oct-7-ynoxy-4-oxobutanoic acid. InChIKey: NPWMZOZWVAFQMP-UHFFFAOYSA-N.
| Molecular formula | C13H18O4 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 2-methylidene-4-oct-7-ynoxy-4-oxobutanoic acid |
| InChIKey | NPWMZOZWVAFQMP-UHFFFAOYSA-N |
| SMILES | C=C(CC(=O)OCCCCCCC#C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Itaconate-alkyne, 4-octynyl Itaconate, 2-methylidene-4-oct-7-ynoxy-4-oxobutanoic acid, 2-methylene-butanedioic acid, 4-(7-octyn-1-yl) ester, ITalk, orb1303119, 2-methylene-4-oct-7-ynoxy-4-oxo-butanoic acid, 2-Methylene-4-(oct-7-yn-1-yloxy)-4-oxobutanoic acid, 2-methylidene-4-(oct-7-yn-1-yloxy)-4-oxobutanoic acid