cas: 199596-05-9 — see every product listed under this CAS number, including other names
JIB-04 98% (CAS 199596-05-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1mg, 5mg, 10mg, 25mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A228395-5g |
| cas | 199596-05-9 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 7824.12 Pln | |
| Ambeed | 1mg | 142.31 Pln | |
| Ambeed | 5mg | 192.38 Pln | |
| Ambeed | 10mg | 225.75 Pln | |
| Ambeed | 25mg | 309.19 Pln | |
| Ambeed | 100mg | 548.38 Pln | |
| Ambeed | 250mg | 837.62 Pln | |
| Ambeed | 1g | 2005.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A228395 |
5-chloro-N-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]pyridin-2-amine (CAS 199596-05-9) is a chemical compound with the molecular formula C17H13ClN4 and a molecular weight of 308.8 g/mol. IUPAC name: 5-chloro-N-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]pyridin-2-amine. InChIKey: YHHFKWKMXWRVTJ-OQKWZONESA-N.
| Molecular formula | C17H13ClN4 |
|---|---|
| Molecular weight | 308.8 g/mol |
| IUPAC name | 5-chloro-N-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]pyridin-2-amine |
| InChIKey | YHHFKWKMXWRVTJ-OQKWZONESA-N |
| SMILES | C1=CC=C(C=C1)/C(=N\NC2=NC=C(C=C2)Cl)/C3=CC=CC=N3 |
Computed by PubChem (NCBI)