CAS 199596-05-9 appears in our catalog under these names: JIB-04, JIB-04, 98%, JIB-04/ 98.61% (existing batch purity), JIB–04, JIB-04 98%. Offered by: Chemat Brand, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: on request, 50mg, 2mg, 5mg, 10mg, 25mg, 100mg, 200mg.
5-chloro-N-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]pyridin-2-amine (CAS 199596-05-9) is a chemical compound with the molecular formula C17H13ClN4 and a molecular weight of 308.8 g/mol. IUPAC name: 5-chloro-N-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]pyridin-2-amine. InChIKey: YHHFKWKMXWRVTJ-OQKWZONESA-N.
| Molecular formula | C17H13ClN4 |
|---|---|
| Molecular weight | 308.8 g/mol |
| IUPAC name | 5-chloro-N-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]pyridin-2-amine |
| InChIKey | YHHFKWKMXWRVTJ-OQKWZONESA-N |
| SMILES | C1=CC=C(C=C1)/C(=N\NC2=NC=C(C=C2)Cl)/C3=CC=CC=N3 |
Computed by PubChem (NCBI)