CAS 112393-64-3 appears in our catalog under these names: Alprazolam-d3 (1mg/ml in Acetonitrile), Alprazolam-d3. Offered by: TRC, Biosynth. Available pack sizes: 1x1ml, 10mg, 1mg, 5mg, 25mg, 50mg.
8-chloro-6-phenyl-1-(trideuteriomethyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (CAS 112393-64-3) is a chemical compound with the molecular formula C17H13ClN4 and a molecular weight of 311.8 g/mol. IUPAC name: 8-chloro-6-phenyl-1-(trideuteriomethyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine. InChIKey: VREFGVBLTWBCJP-FIBGUPNXSA-N.
| Molecular formula | C17H13ClN4 |
|---|---|
| Molecular weight | 311.8 g/mol |
| IUPAC name | 8-chloro-6-phenyl-1-(trideuteriomethyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| InChIKey | VREFGVBLTWBCJP-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NN=C2N1C3=C(C=C(C=C3)Cl)C(=NC2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)