Products 199596-06-0
CAS 199596-06-0 is the registry number for 2-Chloro-6-(2-(phenyl(pyridin-2-yl)methylene)hydrazinyl)pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-N-[[phenyl(pyridin-2-yl)methylidene]amino]pyridin-2-amine (CAS 199596-06-0) is a chemical compound with the molecular formula C17H13ClN4 and a molecular weight of 308.8 g/mol. IUPAC name: 6-chloro-N-[[phenyl(pyridin-2-yl)methylidene]amino]pyridin-2-amine. InChIKey: ZTVHOJJNCSNGLC-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN4 |
|---|---|
| Molecular weight | 308.8 g/mol |
| IUPAC name | 6-chloro-N-[[phenyl(pyridin-2-yl)methylidene]amino]pyridin-2-amine |
| InChIKey | ZTVHOJJNCSNGLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=NNC2=NC(=CC=C2)Cl)C3=CC=CC=N3 |
Computed by PubChem (NCBI)