CAS 1952276-71-9 appears in our catalog under these names: KCL-286/ 99.93% (existing batch purity), KCL–286, KCL-286, KCL-286, 98.93%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg, 10mg, 200mg, 5 mg.
4-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazol-3-yl]benzoic acid (CAS 1952276-71-9) is a chemical compound with the molecular formula C19H14N2O4 and a molecular weight of 334.3 g/mol. IUPAC name: 4-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazol-3-yl]benzoic acid. InChIKey: AVCXUODHLRZJJP-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O4 |
|---|---|
| Molecular weight | 334.3 g/mol |
| IUPAC name | 4-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazol-3-yl]benzoic acid |
| InChIKey | AVCXUODHLRZJJP-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(OC2=C(C=C1)C)C3=NC(=NO3)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)