cas: 349-58-6 — see every product listed under this CAS number, including other names
KG-655 97% (CAS 349-58-6) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A114953-1000g |
| cas | 349-58-6 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 3880.31 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 548.38 Pln | |
| Ambeed | 500g | 2445.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A114953 |
3,5-bis(trifluoromethyl)phenol (CAS 349-58-6) is a chemical compound with the molecular formula C8H4F6O and a molecular weight of 230.11 g/mol. IUPAC name: 3,5-bis(trifluoromethyl)phenol. InChIKey: ODSXJQYJADZFJX-UHFFFAOYSA-N.
| Molecular formula | C8H4F6O |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 3,5-bis(trifluoromethyl)phenol |
| InChIKey | ODSXJQYJADZFJX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)O)C(F)(F)F |
Computed by PubChem (NCBI)