cas: 141315-50-6 — see every product listed under this CAS number, including other names
L-(+)-(2-Chlorophenyl)glycine, 95% (CAS 141315-50-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011647-1G |
| cas | 141315-50-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 10g | 320.74 Pln | |
| Fluorochem | 25g | 633.13 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-amino-2-(2-chlorophenyl)acetic acid (CAS 141315-50-6) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: (2S)-2-amino-2-(2-chlorophenyl)acetic acid. InChIKey: LMIZLNPFTRQPSF-ZETCQYMHSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | (2S)-2-amino-2-(2-chlorophenyl)acetic acid |
| InChIKey | LMIZLNPFTRQPSF-ZETCQYMHSA-N |
| SMILES | C1=CC=C(C(=C1)[C@@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)