CAS 141315-50-6 appears in our catalog under these names: L-2-Chlorophenylglycine, 98%, L–(+)–2–(2–Chlorophenyl)glycine, L-(+)-2-Chlorophenylglycine, (S)-2-Amino-2-(2-chlorophenyl)acetic acid, 98%, 98%, (S)-2-Amino-2-(2-chlorophenyl)acetic acid, 99.0%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100g, 1kg, 25g, 5g, 500g, 10g, 50g, 1g.
(2S)-2-amino-2-(2-chlorophenyl)acetic acid (CAS 141315-50-6) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: (2S)-2-amino-2-(2-chlorophenyl)acetic acid. InChIKey: LMIZLNPFTRQPSF-ZETCQYMHSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | (2S)-2-amino-2-(2-chlorophenyl)acetic acid |
| InChIKey | LMIZLNPFTRQPSF-ZETCQYMHSA-N |
| SMILES | C1=CC=C(C(=C1)[C@@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)