CAS 141196-64-7 appears in our catalog under these names: DL–2–(2–Chlorophenyl)glycine, 2-Amino-2-(2-chlorophenyl)acetic acid, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 100g, 25g, 5g, 50g, 250g.
2-amino-2-(2-chlorophenyl)acetic acid (CAS 141196-64-7) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 2-amino-2-(2-chlorophenyl)acetic acid. InChIKey: LMIZLNPFTRQPSF-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-amino-2-(2-chlorophenyl)acetic acid |
| InChIKey | LMIZLNPFTRQPSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)N)Cl |
Computed by PubChem (NCBI)