L-(+)-Ribose, 97%
cas: 24259-59-4 — see every product listed under this CAS number, including other names
L-(+)-Ribose, 97% (CAS 24259-59-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 10g, 25g, 100g, 250g, 500g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F229146-100MG |
| cas | 24259-59-4 |
| size | 100mg |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 195.78 Pln | |
| Fluorochem | 100g | 518.59 Pln | |
| Fluorochem | 250g | 1205.84 Pln | |
| Fluorochem | 500g | 2278.38 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 231.31 Pln | |
| Ambeed | 100g | 654.06 Pln | |
| Ambeed | 500g | 2801.19 Pln | |
| Ambeed | 1kg | 4442.12 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Aldehydo-L-ribose is a L-ribose and an aldehydo-ribose. It is an enantiomer of an aldehydo-D-ribose.
Source: ChEBI
| Molecular formula | C5H10O5 |
|---|---|
| Molecular weight | 150.13 g/mol |
| IUPAC name | (2S,3S,4S)-2,3,4,5-tetrahydroxypentanal |
| InChIKey | PYMYPHUHKUWMLA-MROZADKFSA-N |
| SMILES | C([C@@H]([C@@H]([C@@H](C=O)O)O)O)O |
Computed by PubChem (NCBI)