CAS 101615-87-6 appears in our catalog under these names: D-Arabinose-2-13C, D-Arabinose-13C-3. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 5mg, 1mg.
(2S,3R,4R)-2,3,4,5-tetrahydroxy(213C)pentanal (CAS 101615-87-6) is a chemical compound with the molecular formula C5H10O5 and a molecular weight of 151.12 g/mol. IUPAC name: (2S,3R,4R)-2,3,4,5-tetrahydroxy(213C)pentanal. InChIKey: PYMYPHUHKUWMLA-GZOCJTDTSA-N.
| Molecular formula | C5H10O5 |
|---|---|
| Molecular weight | 151.12 g/mol |
| IUPAC name | (2S,3R,4R)-2,3,4,5-tetrahydroxy(213C)pentanal |
| InChIKey | PYMYPHUHKUWMLA-GZOCJTDTSA-N |
| SMILES | C([C@H]([C@H]([13C@@H](C=O)O)O)O)O |
Computed by PubChem (NCBI)