CAS 70849-23-9 appears in our catalog under these names: D-Arabinose-1-13C, 98% 98%atom%13C, Arabinose-1-13C, 98.0%. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 25 mg, 10 mg.
(2S,3R,4R)-2,3,4,5-tetrahydroxy(113C)pentanal (CAS 70849-23-9) is a chemical compound with the molecular formula C5H10O5 and a molecular weight of 151.12 g/mol. IUPAC name: (2S,3R,4R)-2,3,4,5-tetrahydroxy(113C)pentanal. InChIKey: PYMYPHUHKUWMLA-PVQXRQKHSA-N.
| Molecular formula | C5H10O5 |
|---|---|
| Molecular weight | 151.12 g/mol |
| IUPAC name | (2S,3R,4R)-2,3,4,5-tetrahydroxy(113C)pentanal |
| InChIKey | PYMYPHUHKUWMLA-PVQXRQKHSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([13CH]=O)O)O)O)O |
Computed by PubChem (NCBI)