CAS 31178-70-8 is the registry number for D-xylose. Offered by: Chemat Brand. Available pack sizes: on request.
Aldehydo-D-xylose is a D-xylose. It has a role as a Saccharomyces cerevisiae metabolite and a human metabolite.
Source: ChEBI
| Molecular formula | C5H10O5 |
|---|---|
| Molecular weight | 150.13 g/mol |
| IUPAC name | (2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
| InChIKey | PYMYPHUHKUWMLA-VPENINKCSA-N |
| SMILES | C([C@H]([C@@H]([C@H](C=O)O)O)O)O |
Computed by PubChem (NCBI)