CAS 39741-62-3 appears in our catalog under these names: L-Glutamine tert-Butyl Ester Hydrochloride, H–Gln–OtBu·HCl, H-L-Gln-OtBu*HCl, L-Glutamine tert-butyl ester hydrochloride, 98% , L-Glutamine tert-Butyl Ester Hydrochloride, 98%, 98%. Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 10g.
Tert-butyl 2,5-diamino-5-oxopentanoate;hydrochloride (CAS 39741-62-3) is a chemical compound with the molecular formula C9H19ClN2O3 and a molecular weight of 238.71 g/mol. IUPAC name: tert-butyl 2,5-diamino-5-oxopentanoate;hydrochloride. InChIKey: ZEPNUNKDKQACNC-UHFFFAOYSA-N.
| Molecular formula | C9H19ClN2O3 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | tert-butyl 2,5-diamino-5-oxopentanoate;hydrochloride |
| InChIKey | ZEPNUNKDKQACNC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(CCC(=O)N)N.Cl |
Computed by PubChem (NCBI)