cas: 71-00-1 — see every product listed under this CAS number, including other names
L-Histidine, 98% (CAS 71-00-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 10g, 50g, 250g, 1kg, 5kg. Offered by: Thermo Scientific (Acros), Chemat, BLDpharm.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 166150250 |
| cas | 71-00-1 |
| size | 25g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 25g | 220.50 Pln | |
| Thermo Scientific (Acros) | 100g | 610.26 Pln | |
| Thermo Scientific (Acros) | 500g | 2980.03 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 74.00 Pln | |
| Chemat | 50g | 83.60 Pln | |
| Chemat | 100g | 93.20 Pln | |
| Chemat | 250g | 131.60 Pln | |
| Chemat | 500g | 254.40 Pln | |
| Chemat | 1kg | 424.40 Pln | |
| Chemat | 5kg | 2212.80 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 25g | 208.84 Pln | |
| BLDpharm | 100g | 236.61 Pln | |
| BLDpharm | 500g | 453.20 Pln | |
| BLDpharm | 1kg | 530.95 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
L-histidine is the L-enantiomer of the amino acid histidine. It has a role as a micronutrient, a nutraceutical, a mouse metabolite, a Saccharomyces cerevisiae metabolite, an Escherichia coli metabolite, a human metabolite and an algal metabolite. It is a L-alpha-amino acid, a histidine and a proteinogenic amino acid. It is a conjugate base of a L-histidinium(1+). It is a conjugate acid of a L-histidinate(1-). It is an enantiomer of a D-histidine. It is a tautomer of a L-histidine zwitterion.
Source: ChEBI
| Molecular formula | C6H9N3O2 |
|---|---|
| Molecular weight | 155.15 g/mol |
| IUPAC name | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid |
| InChIKey | HNDVDQJCIGZPNO-YFKPBYRVSA-N |
| SMILES | C1=C(NC=N1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)