Products 344299-50-9
CAS 344299-50-9 appears in our catalog under these names: DL-Histidine-2,3,3-d3, DL-Histidine-Alpha,Beta,Beta-d3, >95% (HPLC), DL-Histidine-alpha,beta,beta-d3, 98 atom % D, min 98% Chemical Purity, DL–Histidine–d3, DL-Histidine-d3, 99.0%. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 5mg, 0,01g, 0,005g, 1mg, 500μg, 5 mg.
2-amino-2,3,3-trideuterio-3-(1H-imidazol-5-yl)propanoic acid (CAS 344299-50-9) is a chemical compound with the molecular formula C6H9N3O2 and a molecular weight of 158.17 g/mol. IUPAC name: 2-amino-2,3,3-trideuterio-3-(1H-imidazol-5-yl)propanoic acid. InChIKey: HNDVDQJCIGZPNO-WSWICNJZSA-N.
| Molecular formula | C6H9N3O2 |
|---|---|
| Molecular weight | 158.17 g/mol |
| IUPAC name | 2-amino-2,3,3-trideuterio-3-(1H-imidazol-5-yl)propanoic acid |
| InChIKey | HNDVDQJCIGZPNO-WSWICNJZSA-N |
| SMILES | [2H]C([2H])(C1=CN=CN1)C([2H])(C(=O)O)N |
Computed by PubChem (NCBI)