Products 1217456-12-6
CAS 1217456-12-6 is the registry number for L-Histidine-15N3. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
(2S)-2-(15N)azanyl-3-((1,3-15N2)1H-imidazol-5-yl)propanoic acid (CAS 1217456-12-6) is a chemical compound with the molecular formula C6H9N3O2 and a molecular weight of 158.13 g/mol. IUPAC name: (2S)-2-(15N)azanyl-3-((1,3-15N2)1H-imidazol-5-yl)propanoic acid. InChIKey: HNDVDQJCIGZPNO-ZSJBPYFGSA-N.
| Molecular formula | C6H9N3O2 |
|---|---|
| Molecular weight | 158.13 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-3-((1,3-15N2)1H-imidazol-5-yl)propanoic acid |
| InChIKey | HNDVDQJCIGZPNO-ZSJBPYFGSA-N |
| SMILES | C1=C([15NH]C=[15N]1)C[C@@H](C(=O)O)[15NH2] |
Computed by PubChem (NCBI)