CAS 741656-40-6 is the registry number for L-Histidine-13C6,15N3. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-(15N)azanyl-3-((2,4,5-13C3,1,3-15N2)1H-imidazol-5-yl)(1,2,3-13C3)propanoic acid (CAS 741656-40-6) is a chemical compound with the molecular formula C6H9N3O2 and a molecular weight of 164.091 g/mol. IUPAC name: (2S)-2-(15N)azanyl-3-((2,4,5-13C3,1,3-15N2)1H-imidazol-5-yl)(1,2,3-13C3)propanoic acid. InChIKey: HNDVDQJCIGZPNO-SOVAVUQXSA-N.
| Molecular formula | C6H9N3O2 |
|---|---|
| Molecular weight | 164.091 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-3-((2,4,5-13C3,1,3-15N2)1H-imidazol-5-yl)(1,2,3-13C3)propanoic acid |
| InChIKey | HNDVDQJCIGZPNO-SOVAVUQXSA-N |
| SMILES | [13CH]1=[13C]([15NH][13CH]=[15N]1)[13CH2][13C@@H]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)