cas: 2748-02-9 — see every product listed under this CAS number, including other names
L-Leucine tert-Butyl Ester Hydrochloride, >98.0%(T) (CAS 2748-02-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | L0197-1G |
| cas | 2748-02-9 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 118.35 Pln | |
| TCI | 5g | 260.95 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
Tert-butyl (2S)-2-amino-4-methylpentanoate;hydrochloride (CAS 2748-02-9) is a chemical compound with the molecular formula C10H22ClNO2 and a molecular weight of 223.74 g/mol. IUPAC name: tert-butyl (2S)-2-amino-4-methylpentanoate;hydrochloride. InChIKey: RFUWRXIYTQGFGA-QRPNPIFTSA-N.
| Molecular formula | C10H22ClNO2 |
|---|---|
| Molecular weight | 223.74 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-4-methylpentanoate;hydrochloride |
| InChIKey | RFUWRXIYTQGFGA-QRPNPIFTSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)