L-Leucine-15N, 98% 98atom%15N
cas: 59935-31-8 — see every product listed under this CAS number, including other names
L-Leucine-15N, 98% 98atom%15N (CAS 59935-31-8) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat, BLDpharm, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11EDOA-10mg |
| cas | 59935-31-8 |
| size | 10mg |
| availability | 1.25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 299.60 Pln | |
| Chemat | 25mg | 486.80 Pln | |
| Chemat | 50mg | 779.60 Pln | |
| Chemat | 100mg | 1149.20 Pln | |
| Chemat | 250mg | 2272.40 Pln | |
| BLDpharm | 10mg | 331.02 Pln | |
| BLDpharm | 25mg | 569.82 Pln | |
| BLDpharm | 100mg | 1286.24 Pln | |
| Fluorochem | 250mg | 4204.79 Pln |
properties
| purity | 98% 98atom%15N |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(15N)azanyl-4-methylpentanoic acid (CAS 59935-31-8) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 132.17 g/mol. IUPAC name: (2S)-2-(15N)azanyl-4-methylpentanoic acid. InChIKey: ROHFNLRQFUQHCH-GEERXGHESA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 132.17 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-4-methylpentanoic acid |
| InChIKey | ROHFNLRQFUQHCH-GEERXGHESA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)[15NH2] |
Computed by PubChem (NCBI)