CAS 259225-40-6 appears in our catalog under these names: DL-Leucine-d7 (iso-propyl-d7), DL-Leucine-d7 (iso-propyl-d7), 98 atom % D, min 98% Chemical Purity, DL–Leucine–isopropyl–d7, (±)-Leucine-d7, 99.89%. Offered by: Chemat Brand, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 0,25g, 0,1g, 10mg, 1 mg, 5 mg, 10 mg.
2-amino-4,5,5,5-tetradeuterio-4-(trideuteriomethyl)pentanoic acid (CAS 259225-40-6) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 138.22 g/mol. IUPAC name: 2-amino-4,5,5,5-tetradeuterio-4-(trideuteriomethyl)pentanoic acid. InChIKey: ROHFNLRQFUQHCH-UAVYNJCWSA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 138.22 g/mol |
| IUPAC name | 2-amino-4,5,5,5-tetradeuterio-4-(trideuteriomethyl)pentanoic acid |
| InChIKey | ROHFNLRQFUQHCH-UAVYNJCWSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(CC(C(=O)O)N)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)