CAS 59935-31-8 appears in our catalog under these names: L-Leucine-15N, >95% (HPLC), L–Leucine–15N, L-LEUCINE-15N, 98+ ATOM % 15N, L-Leucine-15N, 98% 98atom%15N, 98% 98atom%15N, L-Leucine-15N, 98.0%. Offered by: TRC, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 25mg, 500MG, 250mg, 100 mg, 25 mg.
(2S)-2-(15N)azanyl-4-methylpentanoic acid (CAS 59935-31-8) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 132.17 g/mol. IUPAC name: (2S)-2-(15N)azanyl-4-methylpentanoic acid. InChIKey: ROHFNLRQFUQHCH-GEERXGHESA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 132.17 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-4-methylpentanoic acid |
| InChIKey | ROHFNLRQFUQHCH-GEERXGHESA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)[15NH2] |
Computed by PubChem (NCBI)