Products 201612-66-0

CAS 201612-66-0 appears in our catalog under these names: 2-13C leucine, L-Leucine-2-13C. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 5mg, 1mg.

Structural formula: {0} (CAS {1})

(2S)-2-amino-4-methyl(213C)pentanoic acid (CAS 201612-66-0) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 132.17 g/mol. IUPAC name: (2S)-2-amino-4-methyl(213C)pentanoic acid. InChIKey: ROHFNLRQFUQHCH-IJPZVAHNSA-N.

Identity
Molecular formulaC6H13NO2
Molecular weight132.17 g/mol
IUPAC name(2S)-2-amino-4-methyl(213C)pentanoic acid
InChIKeyROHFNLRQFUQHCH-IJPZVAHNSA-N
SMILESCC(C)C[13C@@H](C(=O)O)N

Computed by PubChem (NCBI)