cas: 24250-84-8 — see every product listed under this CAS number, including other names
L-p-Bromophenylalanine, 97% (CAS 24250-84-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040892-1G |
| cas | 24250-84-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 10g | 289.50 Pln | |
| Fluorochem | 25g | 549.82 Pln | |
| Fluorochem | 50g | 997.58 Pln | |
| Fluorochem | 100g | 1903.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-bromo-L-phenylalanine is the L-enantiomer of 4-bromophenylalanine. It is a 4-bromophenylalanine and a L-phenylalanine derivative. It is an enantiomer of a 4-bromo-D-phenylalanine.
Source: ChEBI
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-bromophenyl)propanoic acid |
| InChIKey | PEMUHKUIQHFMTH-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)N)Br |
Computed by PubChem (NCBI)