Products 321695-57-2
CAS 321695-57-2 appears in our catalog under these names: L002/ 98.59% (existing batch purity), L002, 4-((((4-Methoxyphenyl)sulfonyl)oxy)imino)-2,6-dimethylcyclohexa-2,5-dien-1-one, 98%, 98%, L002, 99.44%, L002 (Standard). Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 25 mg.
[(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-methoxybenzenesulfonate (CAS 321695-57-2) is a chemical compound with the molecular formula C15H15NO5S and a molecular weight of 321.3 g/mol. IUPAC name: [(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-methoxybenzenesulfonate. InChIKey: VEWFTYOFWIXCIO-UHFFFAOYSA-N.
| Molecular formula | C15H15NO5S |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | [(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-methoxybenzenesulfonate |
| InChIKey | VEWFTYOFWIXCIO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NOS(=O)(=O)C2=CC=C(C=C2)OC)C=C(C1=O)C |
Computed by PubChem (NCBI)