Products 885269-46-5
CAS 885269-46-5 is the registry number for N-(4'-Methoxy-4-biphenylylsulfonyl)glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]acetic acid (CAS 885269-46-5) is a chemical compound with the molecular formula C15H15NO5S and a molecular weight of 321.3 g/mol. IUPAC name: 2-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]acetic acid. InChIKey: ABJHIYYOLIFZLZ-UHFFFAOYSA-N.
| Molecular formula | C15H15NO5S |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | 2-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]acetic acid |
| InChIKey | ABJHIYYOLIFZLZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)S(=O)(=O)NCC(=O)O |
Computed by PubChem (NCBI)