Products 325721-47-9
CAS 325721-47-9 appears in our catalog under these names: 3-(4-Methoxy-phenylsulfamoyl)-4-methyl-benzoic acid, 95%, 3-((4-Methoxyphenyl)sulfamoyl)-4-methylbenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
3-[(4-methoxyphenyl)sulfamoyl]-4-methylbenzoic acid (CAS 325721-47-9) is a chemical compound with the molecular formula C15H15NO5S and a molecular weight of 321.3 g/mol. IUPAC name: 3-[(4-methoxyphenyl)sulfamoyl]-4-methylbenzoic acid. InChIKey: DZAQEXJIYVGGBH-UHFFFAOYSA-N.
| Molecular formula | C15H15NO5S |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | 3-[(4-methoxyphenyl)sulfamoyl]-4-methylbenzoic acid |
| InChIKey | DZAQEXJIYVGGBH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)NC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)