CAS 2055050-87-6 appears in our catalog under these names: LAU159/ 99.38% (existing batch purity), LAU159, LAU-159. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg.
8-chloro-2-(3-methoxyphenyl)-1H-pyrazolo[4,3-c]quinolin-3-one (CAS 2055050-87-6) is a chemical compound with the molecular formula C17H12ClN3O2 and a molecular weight of 325.7 g/mol. IUPAC name: 8-chloro-2-(3-methoxyphenyl)-1H-pyrazolo[4,3-c]quinolin-3-one. InChIKey: PAQDEKQVYZRUSQ-UHFFFAOYSA-N.
| Molecular formula | C17H12ClN3O2 |
|---|---|
| Molecular weight | 325.7 g/mol |
| IUPAC name | 8-chloro-2-(3-methoxyphenyl)-1H-pyrazolo[4,3-c]quinolin-3-one |
| InChIKey | PAQDEKQVYZRUSQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)N2C(=O)C3=CN=C4C=CC(=CC4=C3N2)Cl |
Computed by PubChem (NCBI)