CAS 2407782-01-6 appears in our catalog under these names: LDC7559/ 99.47% (existing batch purity), LDC7559, LDC7559 99%, N-(2-(2-Methoxyphenyl)-4,10-dihydrobenzo[f]pyrazolo[5,1-c][1,4]oxazepin-7-yl)acetamide, 99.80% ,, 99.80% ,, LDC7559, 99.51%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1 mg.
N-[2-(2-methoxyphenyl)-4,10-dihydropyrazolo[5,1-c][1,4]benzoxazepin-7-yl]acetamide (CAS 2407782-01-6) is a chemical compound with the molecular formula C20H19N3O3 and a molecular weight of 349.4 g/mol. IUPAC name: N-[2-(2-methoxyphenyl)-4,10-dihydropyrazolo[5,1-c][1,4]benzoxazepin-7-yl]acetamide. InChIKey: IFOIINXSFCQLOV-UHFFFAOYSA-N.
| Molecular formula | C20H19N3O3 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | N-[2-(2-methoxyphenyl)-4,10-dihydropyrazolo[5,1-c][1,4]benzoxazepin-7-yl]acetamide |
| InChIKey | IFOIINXSFCQLOV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC2=C(CN3C(=CC(=N3)C4=CC=CC=C4OC)CO2)C=C1 |
Computed by PubChem (NCBI)