CAS 20829-53-2 appears in our catalog under these names: Cyclo(-trp-tyr), 95%, Cyclo(–Trp–Tyr), Cyclo(-L-Trp-L-Tyr). Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 5g, 50mg, 25mg, 100mg, 500mg.
3-[(4-hydroxyphenyl)methyl]-6-(1H-indol-3-ylmethyl)piperazine-2,5-dione (CAS 20829-53-2) is a chemical compound with the molecular formula C20H19N3O3 and a molecular weight of 349.4 g/mol. IUPAC name: 3-[(4-hydroxyphenyl)methyl]-6-(1H-indol-3-ylmethyl)piperazine-2,5-dione. InChIKey: ZJDMXAAEAVGGSK-UHFFFAOYSA-N.
| Molecular formula | C20H19N3O3 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 3-[(4-hydroxyphenyl)methyl]-6-(1H-indol-3-ylmethyl)piperazine-2,5-dione |
| InChIKey | ZJDMXAAEAVGGSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC3C(=O)NC(C(=O)N3)CC4=CC=C(C=C4)O |
Computed by PubChem (NCBI)