Products 951661-82-8
CAS 951661-82-8 appears in our catalog under these names: Tadalafil Impurity K, Tadalafil Impurity 22, Tadalafil Impurity 31, (1R,3R)-1-(1,3-Benzodioxol-5-yl)-2,3,4,9-tetrahydro-N-methyl-1H-pyrido(3,4-b)indole-3-carboxamide, Tadalafil impurity B. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 2mg.
(1R,3R)-1-(1,3-benzodioxol-5-yl)-N-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide (CAS 951661-82-8) is a chemical compound with the molecular formula C20H19N3O3 and a molecular weight of 349.4 g/mol. IUPAC name: (1R,3R)-1-(1,3-benzodioxol-5-yl)-N-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide. InChIKey: QWRJNDUNSMFZTP-CRAIPNDOSA-N.
| Molecular formula | C20H19N3O3 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | (1R,3R)-1-(1,3-benzodioxol-5-yl)-N-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide |
| InChIKey | QWRJNDUNSMFZTP-CRAIPNDOSA-N |
| SMILES | CNC(=O)[C@H]1CC2=C([C@H](N1)C3=CC4=C(C=C3)OCO4)NC5=CC=CC=C25 |
Computed by PubChem (NCBI)
Synonyms:
Tadalafil Impurity K