CAS 221176-49-4 appears in our catalog under these names: 2-Methyl-5,10-dihydro-4h-benzo[b]thieno[2,3-e][1,4]diazepin-4-one, 95%, Olanzapine EP Impurity B (Olanzapine Amide), Olanzapine EP Impurity B, 5,10-Dihydro-2-methyl-4H-thieno(2,3-b)(1,5)benzodiazepin-4-one (Olanzapine Impurity), >95% (HPLC), 5,10-Dihydro-2-methyl-4H-thieno(2,3-b)(1,5)benzodiazepin-4-one(Olanzapine Impurity), >95% (HPLC). Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, TargetMol. Available pack sizes: 250mg, 500mg, on request, 10mg, 25mg, 5mg, 1mg, 50mg.
2-methyl-5,10-dihydrothieno[3,2-c][1,5]benzodiazepin-4-one (CAS 221176-49-4) is a chemical compound with the molecular formula C12H10N2OS and a molecular weight of 230.29 g/mol. IUPAC name: 2-methyl-5,10-dihydrothieno[3,2-c][1,5]benzodiazepin-4-one. InChIKey: LVTDAJJOMLNXFS-UHFFFAOYSA-N.
| Molecular formula | C12H10N2OS |
|---|---|
| Molecular weight | 230.29 g/mol |
| IUPAC name | 2-methyl-5,10-dihydrothieno[3,2-c][1,5]benzodiazepin-4-one |
| InChIKey | LVTDAJJOMLNXFS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)NC3=CC=CC=C3NC2=O |
Computed by PubChem (NCBI)