CAS 111974-80-2 appears in our catalog under these names: 4-(3-(2-Hydroxy-2-phenyl)ethylamino-3-methylbutyl)benzamide, LY195448/ 99.05% (existing batch purity), LY-195448. Offered by: Chemat, TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 10 mg, 1 mg, 50 mg.
4-[3-[[(2R)-2-hydroxy-2-phenylethyl]amino]-3-methylbutyl]benzamide (CAS 111974-80-2) is a chemical compound with the molecular formula C20H26N2O2 and a molecular weight of 326.4 g/mol. IUPAC name: 4-[3-[[(2R)-2-hydroxy-2-phenylethyl]amino]-3-methylbutyl]benzamide. InChIKey: SYZWOOODCAMXPL-SFHVURJKSA-N.
| Molecular formula | C20H26N2O2 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 4-[3-[[(2R)-2-hydroxy-2-phenylethyl]amino]-3-methylbutyl]benzamide |
| InChIKey | SYZWOOODCAMXPL-SFHVURJKSA-N |
| SMILES | CC(C)(CCC1=CC=C(C=C1)C(=O)N)NC[C@@H](C2=CC=CC=C2)O |
Computed by PubChem (NCBI)