cas: 4156-75-6 — see every product listed under this CAS number, including other names
Lactone-(5-hydroxymethyl)orotic acid, 97%, 97% (CAS 4156-75-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C1HY-1g |
| cas | 4156-75-6 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2709.20 Pln | |
| Chemat | 5g | 7984.40 Pln | |
| Chemat | 10g | 12731.60 Pln | |
| Chemat | 25g | 23810.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,5-dihydrofuro[3,4-d]pyrimidine-2,4,7-trione (CAS 4156-75-6) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: 1,5-dihydrofuro[3,4-d]pyrimidine-2,4,7-trione. InChIKey: MFHLWNMYHQMDMV-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | 1,5-dihydrofuro[3,4-d]pyrimidine-2,4,7-trione |
| InChIKey | MFHLWNMYHQMDMV-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=O)O1)NC(=O)NC2=O |
Computed by PubChem (NCBI)