Products 72361-67-2
CAS 72361-67-2 appears in our catalog under these names: Laetanine/ 96%, Laetanine, Laetanine, 96.12%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 20mg, 10mM/1mL.
(6aS)-1,9-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol (CAS 72361-67-2) is a chemical compound with the molecular formula C18H19NO4 and a molecular weight of 313.3 g/mol. IUPAC name: (6aS)-1,9-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol. InChIKey: URQAEFLEDPPPFX-LBPRGKRZSA-N.
| Molecular formula | C18H19NO4 |
|---|---|
| Molecular weight | 313.3 g/mol |
| IUPAC name | (6aS)-1,9-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol |
| InChIKey | URQAEFLEDPPPFX-LBPRGKRZSA-N |
| SMILES | COC1=C(C=C2C(=C1)C[C@H]3C4=C2C(=C(C=C4CCN3)O)OC)O |
Computed by PubChem (NCBI)