CAS 222986-59-6 is the registry number for 4-(4-BOC-Aminophenyl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]benzoic acid (CAS 222986-59-6) is a chemical compound with the molecular formula C18H19NO4 and a molecular weight of 313.3 g/mol. IUPAC name: 4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]benzoic acid. InChIKey: MPYIQVSAEHFQHB-UHFFFAOYSA-N.
| Molecular formula | C18H19NO4 |
|---|---|
| Molecular weight | 313.3 g/mol |
| IUPAC name | 4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]benzoic acid |
| InChIKey | MPYIQVSAEHFQHB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)