Products 222986-59-6

CAS 222986-59-6 is the registry number for 4-(4-BOC-Aminophenyl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]benzoic acid (CAS 222986-59-6) is a chemical compound with the molecular formula C18H19NO4 and a molecular weight of 313.3 g/mol. IUPAC name: 4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]benzoic acid. InChIKey: MPYIQVSAEHFQHB-UHFFFAOYSA-N.

Identity
Molecular formulaC18H19NO4
Molecular weight313.3 g/mol
IUPAC name4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]benzoic acid
InChIKeyMPYIQVSAEHFQHB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)