CAS 904086-01-7 appears in our catalog under these names: 3-(3-BOC-Aminophenyl)benzoic acid, 95%, 3'-((tert-Butoxycarbonyl)amino)-(1,1'-biphenyl)-3-carboxylic acid, 95%, 3'-((tert-Butoxycarbonyl)amino)-(1,1'-biphenyl)-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 50mg.
3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]benzoic acid (CAS 904086-01-7) is a chemical compound with the molecular formula C18H19NO4 and a molecular weight of 313.3 g/mol. IUPAC name: 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]benzoic acid. InChIKey: LDFRDLKJPCOLHU-UHFFFAOYSA-N.
| Molecular formula | C18H19NO4 |
|---|---|
| Molecular weight | 313.3 g/mol |
| IUPAC name | 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]benzoic acid |
| InChIKey | LDFRDLKJPCOLHU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=CC(=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)