cas: 521-31-3 — see every product listed under this CAS number, including other names
Luminol 98% (CAS 521-31-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A166579-100mg |
| cas | 521-31-3 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 565.06 Pln | |
| Ambeed | 500g | 1850.00 Pln | |
| Ambeed | 1000g | 3096.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A166579 |
5-amino-2,3-dihydrophthalazine-1,4-dione (CAS 521-31-3) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 5-amino-2,3-dihydrophthalazine-1,4-dione. InChIKey: HWYHZTIRURJOHG-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 5-amino-2,3-dihydrophthalazine-1,4-dione |
| InChIKey | HWYHZTIRURJOHG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=O)NNC2=O |
Computed by PubChem (NCBI)