CAS 1189931-96-1 appears in our catalog under these names: Luminol-13C4, >95% (HPLC), Luminol-13C4. Offered by: TRC, Biosynth. Available pack sizes: 0,5mg, 5mg, 10mg, 25mg, 50mg.
5-amino-2,3-dihydrophthalazine-1,4-dione (CAS 1189931-96-1) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 181.13 g/mol. IUPAC name: 5-amino-2,3-dihydrophthalazine-1,4-dione. InChIKey: HWYHZTIRURJOHG-SAXDBNRNSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 181.13 g/mol |
| IUPAC name | 5-amino-2,3-dihydrophthalazine-1,4-dione |
| InChIKey | HWYHZTIRURJOHG-SAXDBNRNSA-N |
| SMILES | [13CH]1=[13CH]C2=C(C(=O)NNC2=O)[13C](=[13CH]1)N |
Computed by PubChem (NCBI)