cas: 59695-23-7 — see every product listed under this CAS number, including other names
M-MORPHOLINOACETOPHENONE, 97% (CAS 59695-23-7) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F303332-5G |
| cas | 59695-23-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 570.65 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(3-morpholin-4-ylphenyl)ethanone (CAS 59695-23-7) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 1-(3-morpholin-4-ylphenyl)ethanone. InChIKey: WXDCDRGCTJHTRW-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 1-(3-morpholin-4-ylphenyl)ethanone |
| InChIKey | WXDCDRGCTJHTRW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)N2CCOCC2 |
Computed by PubChem (NCBI)