Products 2878360-80-4
CAS 2878360-80-4 appears in our catalog under these names: MCT1-IN-3/ 98.87% (existing batch purity), MCT1-IN-3, MCT1-IN-3, 98.65%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
Methyl (E)-2-cyano-3-[1-[2-(4-methoxyanilino)-2-oxoethyl]indol-3-yl]prop-2-enoate (CAS 2878360-80-4) is a chemical compound with the molecular formula C22H19N3O4 and a molecular weight of 389.4 g/mol. IUPAC name: methyl (E)-2-cyano-3-[1-[2-(4-methoxyanilino)-2-oxoethyl]indol-3-yl]prop-2-enoate. InChIKey: RAJPEVIHJCKTGX-RVDMUPIBSA-N.
| Molecular formula | C22H19N3O4 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | methyl (E)-2-cyano-3-[1-[2-(4-methoxyanilino)-2-oxoethyl]indol-3-yl]prop-2-enoate |
| InChIKey | RAJPEVIHJCKTGX-RVDMUPIBSA-N |
| SMILES | COC1=CC=C(C=C1)NC(=O)CN2C=C(C3=CC=CC=C32)/C=C(\C#N)/C(=O)OC |
Computed by PubChem (NCBI)