Products 2143463-31-2
CAS 2143463-31-2 appears in our catalog under these names: Methyl 3-[[2-(4-pentylphenoxy)acetyl]amino]benzoate, MDH1-IN-1/ 99.36% (existing batch purity), MDH1–IN–1, MDH1-IN-1, 99.97%. Offered by: Chemat, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 2mg, 25mg, 50mg, 100mg, 10mg, 10mM * 1mlindmso, 5mg, 50 mg.
Methyl 3-[[2-(4-pentylphenoxy)acetyl]amino]benzoate (CAS 2143463-31-2) is a chemical compound with the molecular formula C21H25NO4 and a molecular weight of 355.4 g/mol. IUPAC name: methyl 3-[[2-(4-pentylphenoxy)acetyl]amino]benzoate. InChIKey: HDBDOZJTIIABKV-UHFFFAOYSA-N.
| Molecular formula | C21H25NO4 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | methyl 3-[[2-(4-pentylphenoxy)acetyl]amino]benzoate |
| InChIKey | HDBDOZJTIIABKV-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC=C(C=C1)OCC(=O)NC2=CC=CC(=C2)C(=O)OC |
Computed by PubChem (NCBI)