cas: 1236357-64-4 — see every product listed under this CAS number, including other names
METHYL 1-(4-BROMOPHENYL)CYCLOPENTANECARBOXYLATE, 96% (CAS 1236357-64-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F301641-250MG |
| cas | 1236357-64-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 5g | 2002.44 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 1-(4-bromophenyl)cyclopentane-1-carboxylate (CAS 1236357-64-4) is a chemical compound with the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. IUPAC name: methyl 1-(4-bromophenyl)cyclopentane-1-carboxylate. InChIKey: KIYRMNOQZGCLMC-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO2 |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | methyl 1-(4-bromophenyl)cyclopentane-1-carboxylate |
| InChIKey | KIYRMNOQZGCLMC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCCC1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)