cas: 1214362-45-4 — see every product listed under this CAS number, including other names
METHYL 3-BROMO-5-CHLOROPYRIDINE-2-CARBOXYLATE, 98% (CAS 1214362-45-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F306696-250MG |
| cas | 1214362-45-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 331.15 Pln | |
| Fluorochem | 1g | 560.24 Pln | |
| Fluorochem | 5g | 1778.56 Pln | |
| Fluorochem | 10g | 3199.93 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-bromo-5-chloropyridine-2-carboxylate (CAS 1214362-45-4) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: methyl 3-bromo-5-chloropyridine-2-carboxylate. InChIKey: FGGMRJLIUFDXBD-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | methyl 3-bromo-5-chloropyridine-2-carboxylate |
| InChIKey | FGGMRJLIUFDXBD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=N1)Cl)Br |
Computed by PubChem (NCBI)