cas: 55822-86-1 — see every product listed under this CAS number, including other names
METHYL 3-HYDROXY-3-(3-HYDROXYPHENYL)PROPANOATE (CAS 55822-86-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387604-100MG |
| cas | 55822-86-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 976.76 Pln | |
| Fluorochem | 250mg | 1205.84 Pln | |
| Fluorochem | 1g | 3465.46 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 3-hydroxy-3-(3-hydroxyphenyl)propanoate (CAS 55822-86-1) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: methyl 3-hydroxy-3-(3-hydroxyphenyl)propanoate. InChIKey: RJGKHTZHLGBJHK-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | methyl 3-hydroxy-3-(3-hydroxyphenyl)propanoate |
| InChIKey | RJGKHTZHLGBJHK-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=CC(=CC=C1)O)O |
Computed by PubChem (NCBI)