cas: 55822-86-1 — see every product listed under this CAS number, including other names
Methyl 3-Hydroxy-3-(3-hydroxyphenyl)propanoate, >95%, >95% (CAS 55822-86-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RSD-100mg |
| cas | 55822-86-1 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 606.80 Pln | |
| Chemat | 250mg | 746.00 Pln | |
| Chemat | 1g | 2109.20 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-hydroxy-3-(3-hydroxyphenyl)propanoate (CAS 55822-86-1) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: methyl 3-hydroxy-3-(3-hydroxyphenyl)propanoate. InChIKey: RJGKHTZHLGBJHK-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | methyl 3-hydroxy-3-(3-hydroxyphenyl)propanoate |
| InChIKey | RJGKHTZHLGBJHK-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=CC(=CC=C1)O)O |
Computed by PubChem (NCBI)