cas: 1007455-28-8 — see every product listed under this CAS number, including other names
METHYL 6-BROMO-2-FLUORO-3-METHOXYBENZOATE, 97% (CAS 1007455-28-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F332373-250MG |
| cas | 1007455-28-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 500mg | 539.41 Pln | |
| Fluorochem | 1g | 706.02 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 6-bromo-2-fluoro-3-methoxybenzoate (CAS 1007455-28-8) is a chemical compound with the molecular formula C9H8BrFO3 and a molecular weight of 263.06 g/mol. IUPAC name: methyl 6-bromo-2-fluoro-3-methoxybenzoate. InChIKey: TWOBQNWSLXGOBW-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO3 |
|---|---|
| Molecular weight | 263.06 g/mol |
| IUPAC name | methyl 6-bromo-2-fluoro-3-methoxybenzoate |
| InChIKey | TWOBQNWSLXGOBW-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)C(=O)OC)F |
Computed by PubChem (NCBI)