Methyl 6-bromo-2-fluoro-3-methoxybenzoate, 97%, 97%
cas: 1007455-28-8 — see every product listed under this CAS number, including other names
Methyl 6-bromo-2-fluoro-3-methoxybenzoate, 97%, 97% (CAS 1007455-28-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1113RJ-5g |
| cas | 1007455-28-8 |
| size | 5g |
| availability | 100g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1734.80 Pln | |
| Chemat | 10g | 2848.40 Pln | |
| Chemat | 25g | 5632.40 Pln | |
| Chemat | 100g | 15846.80 Pln | |
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 500mg | 386.00 Pln | |
| Chemat | 1g | 621.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-bromo-2-fluoro-3-methoxybenzoate (CAS 1007455-28-8) is a chemical compound with the molecular formula C9H8BrFO3 and a molecular weight of 263.06 g/mol. IUPAC name: methyl 6-bromo-2-fluoro-3-methoxybenzoate. InChIKey: TWOBQNWSLXGOBW-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO3 |
|---|---|
| Molecular weight | 263.06 g/mol |
| IUPAC name | methyl 6-bromo-2-fluoro-3-methoxybenzoate |
| InChIKey | TWOBQNWSLXGOBW-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)C(=O)OC)F |
Computed by PubChem (NCBI)