Products 148274-76-4

CAS 148274-76-4 appears in our catalog under these names: MG 1/ 99.73% (existing batch purity), MG 1. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 1 mg, 5 mg.

Structural formula: {0} (CAS {1})

1-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]pyrrolidin-2-one (CAS 148274-76-4) is a chemical compound with the molecular formula C17H25N3O2 and a molecular weight of 303.4 g/mol. IUPAC name: 1-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]pyrrolidin-2-one. InChIKey: AFBKGQPVUQUMRC-UHFFFAOYSA-N.

Identity
Molecular formulaC17H25N3O2
Molecular weight303.4 g/mol
IUPAC name1-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]pyrrolidin-2-one
InChIKeyAFBKGQPVUQUMRC-UHFFFAOYSA-N
SMILESC1CC(=O)N(C1)CC(CN2CCN(CC2)C3=CC=CC=C3)O

Computed by PubChem (NCBI)